C25H24ClFN6 — CID 170100423
6-chloro-2-[3-(dimethylamino)azetidin-1-yl]-8-fluoro-N-(2-iminoethyl)-7-naphthalen-1-ylquinazolin-4-amine (PubChem CID 170100423) has the molecular formula C25H24ClFN6 and a molecular weight of 462.96 g/mol. Its IUPAC name is 6-chloro-2-[3-(dimethylamino)azetidin-1-yl]-8-fluoro-N-(2-iminoethyl)-7-naphthalen-1-ylquinazolin-4-amine.
| Compound Name | 6-chloro-2-[3-(dimethylamino)azetidin-1-yl]-8-fluoro-N-(2-iminoethyl)-7-naphthalen-1-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 170100423 |
| Molecular Formula | C25H24ClFN6 |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 6-chloro-2-[3-(dimethylamino)azetidin-1-yl]-8-fluoro-N-(2-iminoethyl)-7-naphthalen-1-ylquinazolin-4-amine |
| SMILES | [H]/N=C/CNc1nc(N2CC(N(C)C)C2)nc2c(F)c(-c3cccc4ccccc34)c(Cl)cc12 |
| InChI | InChI=1S/C25H24ClFN6/c1-32(2)16-13-33(14-16)25-30-23-19(24(31-25)29-11-10-28)12-20(26)21(22(23)27)18-9-5-7-15-6-3-4-8-17(15)18/h3-10,12,16,28H,11,13-14H2,1-2H3,(H,29,30,31)/b28-10+ |
| InChIKey | LPTAFYUUFAGKHN-ORBVJSQLSA-N |
| XLogP | 5.05 |
| TPSA | 68.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|