C41H40N2 — CID 170097735
N-[4-[4-[N-[(3-methylcyclohepta-1,6-dien-1-yl)methyl]anilino]cyclohexa-2,4-dien-1-yl]phenyl]-N-(3-methylphenyl)cyclohepta-1,3,4,6-tetraen-1-amine (PubChem CID 170097735) has the molecular formula C41H40N2 and a molecular weight of 560.79 g/mol. Its IUPAC name is N-[4-[4-[N-[(3-methylcyclohepta-1,6-dien-1-yl)methyl]anilino]cyclohexa-2,4-dien-1-yl]phenyl]-N-(3-methylphenyl)cyclohepta-1,3,4,6-tetraen-1-amine.
| Compound Name | N-[4-[4-[N-[(3-methylcyclohepta-1,6-dien-1-yl)methyl]anilino]cyclohexa-2,4-dien-1-yl]phenyl]-N-(3-methylphenyl)cyclohepta-1,3,4,6-tetraen-1-amine |
|---|---|
| PubChem CID | 170097735 |
| Molecular Formula | C41H40N2 |
| Molecular Weight | 560.79 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | N-[4-[4-[N-[(3-methylcyclohepta-1,6-dien-1-yl)methyl]anilino]cyclohexa-2,4-dien-1-yl]phenyl]-N-(3-methylphenyl)cyclohepta-1,3,4,6-tetraen-1-amine |
| SMILES | Cc1cccc(N(C2=CC=C=CC=C2)c2ccc(C3C=CC(N(CC4=CC(C)CCC=C4)c4ccccc4)=CC3)cc2)c1 |
| InChI | InChI=1S/C41H40N2/c1-32-13-10-11-15-34(29-32)31-42(37-16-8-5-9-17-37)38-25-21-35(22-26-38)36-23-27-40(28-24-36)43(39-18-6-3-4-7-19-39)41-20-12-14-33(2)30-41/h3,5-9,11-12,14-21,23-30,32,35H,10,13,22,31H2,1-2H3 |
| InChIKey | GLQNRHMTGLODQE-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.79 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |