C53H51N — CID 144660511
4-(9,9-dimethyl-2,3-dihydrofluoren-2-yl)-N-[4-[(2E,4Z)-5-methyl-6-(2-methylphenyl)hexa-2,4-dien-2-yl]phenyl]-N-(4-phenylcyclohexa-1,5-dien-1-yl)aniline (PubChem CID 144660511) has the molecular formula C53H51N and a molecular weight of 702.00 g/mol. Its IUPAC name is 4-(9,9-dimethyl-2,3-dihydrofluoren-2-yl)-N-[4-[(2E,4Z)-5-methyl-6-(2-methylphenyl)hexa-2,4-dien-2-yl]phenyl]-N-(4-phenylcyclohexa-1,5-dien-1-yl)aniline.
| Compound Name | 4-(9,9-dimethyl-2,3-dihydrofluoren-2-yl)-N-[4-[(2E,4Z)-5-methyl-6-(2-methylphenyl)hexa-2,4-dien-2-yl]phenyl]-N-(4-phenylcyclohexa-1,5-dien-1-yl)aniline |
|---|---|
| PubChem CID | 144660511 |
| Molecular Formula | C53H51N |
| Molecular Weight | 702.00 g/mol |
| Exact Mass | 701.40 |
| IUPAC Name | 4-(9,9-dimethyl-2,3-dihydrofluoren-2-yl)-N-[4-[(2E,4Z)-5-methyl-6-(2-methylphenyl)hexa-2,4-dien-2-yl]phenyl]-N-(4-phenylcyclohexa-1,5-dien-1-yl)aniline |
| SMILES | C/C(=C/C=C(\C)c1ccc(N(C2=CCC(c3ccccc3)C=C2)c2ccc(C3C=C4C(=CC3)c3ccccc3C4(C)C)cc2)cc1)Cc1ccccc1C |
| InChI | InChI=1S/C53H51N/c1-37(35-44-16-10-9-13-38(44)2)19-20-39(3)40-21-28-46(29-22-40)54(47-30-23-42(24-31-47)41-14-7-6-8-15-41)48-32-25-43(26-33-48)45-27-34-50-49-17-11-12-18-51(49)53(4,5)52(50)36-45/h6-23,25-26,28-34,36,42,45H,24,27,35H2,1-5H3/b37-19-,39-20+ |
| InChIKey | VKSTZUDPVUUNAD-XQPTYGJNSA-N |
| XLogP | 14.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.00 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|