C28H30ClN3O5 — CID 17009863
N-[1-[1-[3-(4-chlorophenoxy)propyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 17009863) has the molecular formula C28H30ClN3O5 and a molecular weight of 524.02 g/mol. Its IUPAC name is N-[1-[1-[3-(4-chlorophenoxy)propyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[1-[1-[3-(4-chlorophenoxy)propyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 17009863 |
| Molecular Formula | C28H30ClN3O5 |
| Molecular Weight | 524.02 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | N-[1-[1-[3-(4-chlorophenoxy)propyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(C)c2nc3ccccc3n2CCCOc2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C28H30ClN3O5/c1-18(30-28(33)19-16-24(34-2)26(36-4)25(17-19)35-3)27-31-22-8-5-6-9-23(22)32(27)14-7-15-37-21-12-10-20(29)11-13-21/h5-6,8-13,16-18H,7,14-15H2,1-4H3,(H,30,33) |
| InChIKey | WBXFXMPZRUENKY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.02 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|