C29H33N3O5 — CID 17009864
3,4,5-trimethoxy-N-[1-[1-[3-(4-methylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 17009864) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[1-[1-[3-(4-methylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[1-[1-[3-(4-methylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17009864 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 3,4,5-trimethoxy-N-[1-[1-[3-(4-methylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | COc1cc(C(=O)NC(C)c2nc3ccccc3n2CCCOc2ccc(C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H33N3O5/c1-19-11-13-22(14-12-19)37-16-8-15-32-24-10-7-6-9-23(24)31-28(32)20(2)30-29(33)21-17-25(34-3)27(36-5)26(18-21)35-4/h6-7,9-14,17-18,20H,8,15-16H2,1-5H3,(H,30,33) |
| InChIKey | SIDVKEIHHPRHRF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|