C21H32BrN5O2 — CID 170099201
1-[[(1S)-8-[(Z)-2-amino-3-[amino(propan-2-yl)amino]prop-2-enoxy]-5-bromo-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-methylpyrrolidin-2-one (PubChem CID 170099201) has the molecular formula C21H32BrN5O2 and a molecular weight of 466.42 g/mol. Its IUPAC name is 1-[[(1S)-8-[(Z)-2-amino-3-[amino(propan-2-yl)amino]prop-2-enoxy]-5-bromo-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-methylpyrrolidin-2-one.
| Compound Name | 1-[[(1S)-8-[(Z)-2-amino-3-[amino(propan-2-yl)amino]prop-2-enoxy]-5-bromo-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 170099201 |
| Molecular Formula | C21H32BrN5O2 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 1-[[(1S)-8-[(Z)-2-amino-3-[amino(propan-2-yl)amino]prop-2-enoxy]-5-bromo-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-methylpyrrolidin-2-one |
| SMILES | CC1CCN(C[C@H]2NCCc3c(Br)ccc(OC/C(N)=C/N(N)C(C)C)c32)C1=O |
| InChI | InChI=1S/C21H32BrN5O2/c1-13(2)27(24)10-15(23)12-29-19-5-4-17(22)16-6-8-25-18(20(16)19)11-26-9-7-14(3)21(26)28/h4-5,10,13-14,18,25H,6-9,11-12,23-24H2,1-3H3/b15-10-/t14?,18-/m1/s1 |
| InChIKey | ZWSVOPCWKKTMEO-UKALIIDSSA-N |
| XLogP | 2.27 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|