C23H25N5O5S — CID 170101480
(1-ethylsulfonylcyclopropyl)methyl 5-[(4-cyanophenyl)methylcarbamoyl]-3-methanimidoyl-1-methyl-6-oxopyridine-2-carboximidate (PubChem CID 170101480) has the molecular formula C23H25N5O5S and a molecular weight of 483.55 g/mol. Its IUPAC name is (1-ethylsulfonylcyclopropyl)methyl 5-[(4-cyanophenyl)methylcarbamoyl]-3-methanimidoyl-1-methyl-6-oxopyridine-2-carboximidate.
| Compound Name | (1-ethylsulfonylcyclopropyl)methyl 5-[(4-cyanophenyl)methylcarbamoyl]-3-methanimidoyl-1-methyl-6-oxopyridine-2-carboximidate |
|---|---|
| PubChem CID | 170101480 |
| Molecular Formula | C23H25N5O5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | (1-ethylsulfonylcyclopropyl)methyl 5-[(4-cyanophenyl)methylcarbamoyl]-3-methanimidoyl-1-methyl-6-oxopyridine-2-carboximidate |
| SMILES | [H]/N=C(\OCC1(S(=O)(=O)CC)CC1)c1c(/C=N/[H])cc(C(=O)NCc2ccc(C#N)cc2)c(=O)n1C |
| InChI | InChI=1S/C23H25N5O5S/c1-3-34(31,32)23(8-9-23)14-33-20(26)19-17(12-25)10-18(22(30)28(19)2)21(29)27-13-16-6-4-15(11-24)5-7-16/h4-7,10,12,25-26H,3,8-9,13-14H2,1-2H3,(H,27,29)/b25-12+,26-20- |
| InChIKey | JYRUKXPHEKGQMT-SGXUSYFGSA-N |
| XLogP | 1.49 |
| TPSA | 165.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|