C26H31N5O — CID 170101528
[7-[(2E,4Z)-hexa-2,4-dien-2-yl]-6-methyl-4-spiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-1'-ylpyrazolo[1,5-a]pyrazin-3-yl]methanol (PubChem CID 170101528) has the molecular formula C26H31N5O and a molecular weight of 429.57 g/mol. Its IUPAC name is [7-[(2E,4Z)-hexa-2,4-dien-2-yl]-6-methyl-4-spiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-1'-ylpyrazolo[1,5-a]pyrazin-3-yl]methanol.
| Compound Name | [7-[(2E,4Z)-hexa-2,4-dien-2-yl]-6-methyl-4-spiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-1'-ylpyrazolo[1,5-a]pyrazin-3-yl]methanol |
|---|---|
| PubChem CID | 170101528 |
| Molecular Formula | C26H31N5O |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | [7-[(2E,4Z)-hexa-2,4-dien-2-yl]-6-methyl-4-spiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-1'-ylpyrazolo[1,5-a]pyrazin-3-yl]methanol |
| SMILES | C/C=C\C=C(/C)c1c(C)nc(N2CCC3(CC2)Cc2cccnc2C3)c2c(CO)cnn12 |
| InChI | InChI=1S/C26H31N5O/c1-4-5-7-18(2)23-19(3)29-25(24-21(17-32)16-28-31(23)24)30-12-9-26(10-13-30)14-20-8-6-11-27-22(20)15-26/h4-8,11,16,32H,9-10,12-15,17H2,1-3H3/b5-4-,18-7+ |
| InChIKey | VMGXVOABTKDLBP-ITLUXWQVSA-N |
| XLogP | 4.29 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|