C22H28N3O4+ — CID 170102081
[(2R)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]cyclopentyl]methylidene-ethyl-methylazanium (PubChem CID 170102081) has the molecular formula C22H28N3O4+ and a molecular weight of 398.48 g/mol. Its IUPAC name is [(2R)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]cyclopentyl]methylidene-ethyl-methylazanium.
| Compound Name | [(2R)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]cyclopentyl]methylidene-ethyl-methylazanium |
|---|---|
| PubChem CID | 170102081 |
| Molecular Formula | C22H28N3O4+ |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | [(2R)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]cyclopentyl]methylidene-ethyl-methylazanium |
| SMILES | CC/[N+](C)=C/C1CCC[C@H]1Oc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H27N3O4/c1-3-24(2)12-14-5-4-6-19(14)29-16-7-8-17-15(11-16)13-25(22(17)28)18-9-10-20(26)23-21(18)27/h7-8,11-12,14,18-19H,3-6,9-10,13H2,1-2H3/p+1/b24-12+/t14?,18?,19-/m1/s1 |
| InChIKey | JSUUWRZOIUTMAX-SCEHAWCUSA-O |
| XLogP | 1.73 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|