C18H21FN3O2P — CID 170102348
3-amino-N-[4-(1-fluoro-1-phosphanylethoxy)phenyl]-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 170102348) has the molecular formula C18H21FN3O2P and a molecular weight of 361.36 g/mol. Its IUPAC name is 3-amino-N-[4-(1-fluoro-1-phosphanylethoxy)phenyl]-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | 3-amino-N-[4-(1-fluoro-1-phosphanylethoxy)phenyl]-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 170102348 |
| Molecular Formula | C18H21FN3O2P |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 3-amino-N-[4-(1-fluoro-1-phosphanylethoxy)phenyl]-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | CC(F)(P)Oc1ccc(NC(=O)N2CC(N)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C18H21FN3O2P/c1-18(19,25)24-15-8-6-14(7-9-15)21-17(23)22-11-13(20)10-12-4-2-3-5-16(12)22/h2-9,13H,10-11,20,25H2,1H3,(H,21,23) |
| InChIKey | JZSKMKJKQVQWTM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|