C16H11F3N2O3 — CID 118444181
2-oxo-N-[4-(trifluoromethoxy)phenyl]-3H-indole-1-carboxamide (PubChem CID 118444181) has the molecular formula C16H11F3N2O3 and a molecular weight of 336.27 g/mol. Its IUPAC name is 2-oxo-N-[4-(trifluoromethoxy)phenyl]-3H-indole-1-carboxamide.
| Compound Name | 2-oxo-N-[4-(trifluoromethoxy)phenyl]-3H-indole-1-carboxamide |
|---|---|
| PubChem CID | 118444181 |
| Molecular Formula | C16H11F3N2O3 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-oxo-N-[4-(trifluoromethoxy)phenyl]-3H-indole-1-carboxamide |
| SMILES | O=C1Cc2ccccc2N1C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F3N2O3/c17-16(18,19)24-12-7-5-11(6-8-12)20-15(23)21-13-4-2-1-3-10(13)9-14(21)22/h1-8H,9H2,(H,20,23) |
| InChIKey | FFOCVVRPUQAWOC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |