C17H24F2N3O4PS — CID 170102648
N-[(3R)-1-[2-[4-[difluoro(methylphosphanyl)methoxy]anilino]acetyl]piperidin-3-yl]ethenesulfonamide (PubChem CID 170102648) has the molecular formula C17H24F2N3O4PS and a molecular weight of 435.43 g/mol. Its IUPAC name is N-[(3R)-1-[2-[4-[difluoro(methylphosphanyl)methoxy]anilino]acetyl]piperidin-3-yl]ethenesulfonamide.
| Compound Name | N-[(3R)-1-[2-[4-[difluoro(methylphosphanyl)methoxy]anilino]acetyl]piperidin-3-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 170102648 |
| Molecular Formula | C17H24F2N3O4PS |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[(3R)-1-[2-[4-[difluoro(methylphosphanyl)methoxy]anilino]acetyl]piperidin-3-yl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)N[C@@H]1CCCN(C(=O)CNc2ccc(OC(F)(F)PC)cc2)C1 |
| InChI | InChI=1S/C17H24F2N3O4PS/c1-3-28(24,25)21-14-5-4-10-22(12-14)16(23)11-20-13-6-8-15(9-7-13)26-17(18,19)27-2/h3,6-9,14,20-21,27H,1,4-5,10-12H2,2H3/t14-/m1/s1 |
| InChIKey | JACCTJGGCZDQIX-CQSZACIVSA-N |
| XLogP | 2.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|