C20H32N2O4S — CID 47082365
N-[1-[2-(4-tert-butylphenoxy)propanoyl]piperidin-3-yl]ethanesulfonamide (PubChem CID 47082365) has the molecular formula C20H32N2O4S and a molecular weight of 396.55 g/mol. Its IUPAC name is N-[1-[2-(4-tert-butylphenoxy)propanoyl]piperidin-3-yl]ethanesulfonamide.
| Compound Name | N-[1-[2-(4-tert-butylphenoxy)propanoyl]piperidin-3-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 47082365 |
| Molecular Formula | C20H32N2O4S |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | N-[1-[2-(4-tert-butylphenoxy)propanoyl]piperidin-3-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1CCCN(C(=O)C(C)Oc2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C20H32N2O4S/c1-6-27(24,25)21-17-8-7-13-22(14-17)19(23)15(2)26-18-11-9-16(10-12-18)20(3,4)5/h9-12,15,17,21H,6-8,13-14H2,1-5H3 |
| InChIKey | MXILSTMWZZLWHT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |