C21H35N3O4S — CID 55493812
4-[2-(4-tert-butylphenoxy)propanoyl]-N,N-diethylpiperazine-1-sulfonamide (PubChem CID 55493812) has the molecular formula C21H35N3O4S and a molecular weight of 425.60 g/mol. Its IUPAC name is 4-[2-(4-tert-butylphenoxy)propanoyl]-N,N-diethylpiperazine-1-sulfonamide.
| Compound Name | 4-[2-(4-tert-butylphenoxy)propanoyl]-N,N-diethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55493812 |
| Molecular Formula | C21H35N3O4S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 4-[2-(4-tert-butylphenoxy)propanoyl]-N,N-diethylpiperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(=O)C(C)Oc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H35N3O4S/c1-7-23(8-2)29(26,27)24-15-13-22(14-16-24)20(25)17(3)28-19-11-9-18(10-12-19)21(4,5)6/h9-12,17H,7-8,13-16H2,1-6H3 |
| InChIKey | AZUHHWOPNDVHCS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |