C16H11ClFN3O3S2 — CID 170103484
5-(4-chlorophenyl)sulfonyl-N-(4-fluoro-3-methylphenyl)thiadiazole-4-carboxamide (PubChem CID 170103484) has the molecular formula C16H11ClFN3O3S2 and a molecular weight of 411.87 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfonyl-N-(4-fluoro-3-methylphenyl)thiadiazole-4-carboxamide.
| Compound Name | 5-(4-chlorophenyl)sulfonyl-N-(4-fluoro-3-methylphenyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 170103484 |
| Molecular Formula | C16H11ClFN3O3S2 |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 5-(4-chlorophenyl)sulfonyl-N-(4-fluoro-3-methylphenyl)thiadiazole-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2nnsc2S(=O)(=O)c2ccc(Cl)cc2)ccc1F |
| InChI | InChI=1S/C16H11ClFN3O3S2/c1-9-8-11(4-7-13(9)18)19-15(22)14-16(25-21-20-14)26(23,24)12-5-2-10(17)3-6-12/h2-8H,1H3,(H,19,22) |
| InChIKey | SBKQPUUPKPVLLE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |