C15H8Cl2FN3O3S2 — CID 166887479
N-(3-chloro-5-fluorophenyl)-5-(4-chlorophenyl)sulfonylthiadiazole-4-carboxamide (PubChem CID 166887479) has the molecular formula C15H8Cl2FN3O3S2 and a molecular weight of 432.29 g/mol. Its IUPAC name is N-(3-chloro-5-fluorophenyl)-5-(4-chlorophenyl)sulfonylthiadiazole-4-carboxamide.
| Compound Name | N-(3-chloro-5-fluorophenyl)-5-(4-chlorophenyl)sulfonylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 166887479 |
| Molecular Formula | C15H8Cl2FN3O3S2 |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 430.94 |
| IUPAC Name | N-(3-chloro-5-fluorophenyl)-5-(4-chlorophenyl)sulfonylthiadiazole-4-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(Cl)c1)c1nnsc1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H8Cl2FN3O3S2/c16-8-1-3-12(4-2-8)26(23,24)15-13(20-21-25-15)14(22)19-11-6-9(17)5-10(18)7-11/h1-7H,(H,19,22) |
| InChIKey | BACMRISSRFNGFZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |