C17H14ClN3O3S2 — CID 170103475
5-(4-chlorophenyl)sulfonyl-N-[(4-methylphenyl)methyl]thiadiazole-4-carboxamide (PubChem CID 170103475) has the molecular formula C17H14ClN3O3S2 and a molecular weight of 407.90 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfonyl-N-[(4-methylphenyl)methyl]thiadiazole-4-carboxamide.
| Compound Name | 5-(4-chlorophenyl)sulfonyl-N-[(4-methylphenyl)methyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 170103475 |
| Molecular Formula | C17H14ClN3O3S2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 5-(4-chlorophenyl)sulfonyl-N-[(4-methylphenyl)methyl]thiadiazole-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2nnsc2S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H14ClN3O3S2/c1-11-2-4-12(5-3-11)10-19-16(22)15-17(25-21-20-15)26(23,24)14-8-6-13(18)7-9-14/h2-9H,10H2,1H3,(H,19,22) |
| InChIKey | RBXVMNNMKJPCEJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |