C21H20BrFN4O6 — CID 170105180
1-[5-bromo-2-(methylamino)benzoyl]-4-[2-(4-fluoro-3-nitrophenoxy)acetyl]piperazine-2-carbaldehyde (PubChem CID 170105180) has the molecular formula C21H20BrFN4O6 and a molecular weight of 523.32 g/mol. Its IUPAC name is 1-[5-bromo-2-(methylamino)benzoyl]-4-[2-(4-fluoro-3-nitrophenoxy)acetyl]piperazine-2-carbaldehyde.
| Compound Name | 1-[5-bromo-2-(methylamino)benzoyl]-4-[2-(4-fluoro-3-nitrophenoxy)acetyl]piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 170105180 |
| Molecular Formula | C21H20BrFN4O6 |
| Molecular Weight | 523.32 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 1-[5-bromo-2-(methylamino)benzoyl]-4-[2-(4-fluoro-3-nitrophenoxy)acetyl]piperazine-2-carbaldehyde |
| SMILES | CNc1ccc(Br)cc1C(=O)N1CCN(C(=O)COc2ccc(F)c([N+](=O)[O-])c2)CC1C=O |
| InChI | InChI=1S/C21H20BrFN4O6/c1-24-18-5-2-13(22)8-16(18)21(30)26-7-6-25(10-14(26)11-28)20(29)12-33-15-3-4-17(23)19(9-15)27(31)32/h2-5,8-9,11,14,24H,6-7,10,12H2,1H3 |
| InChIKey | VGFUCYLYSURLCJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|