C17H21FN2O3 — CID 170106144
tert-butyl N-[(E)-2-[(4-cyanophenoxy)methyl]-3-fluoroprop-2-enyl]-N-methylcarbamate (PubChem CID 170106144) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is tert-butyl N-[(E)-2-[(4-cyanophenoxy)methyl]-3-fluoroprop-2-enyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(E)-2-[(4-cyanophenoxy)methyl]-3-fluoroprop-2-enyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 170106144 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | tert-butyl N-[(E)-2-[(4-cyanophenoxy)methyl]-3-fluoroprop-2-enyl]-N-methylcarbamate |
| SMILES | CN(C/C(=C\F)COc1ccc(C#N)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H21FN2O3/c1-17(2,3)23-16(21)20(4)11-14(9-18)12-22-15-7-5-13(10-19)6-8-15/h5-9H,11-12H2,1-4H3/b14-9+ |
| InChIKey | LUSGAUDFMWCQSK-NTEUORMPSA-N |
| XLogP | 3.66 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |