C30H37FN6O2 — CID 170106611
N-[17-[6-[4-(dimethylamino)piperidin-1-yl]-3-pyridinyl]-16-fluoro-9-methyl-2-oxa-9,13-diazatetracyclo[8.7.1.03,8.014,18]octadeca-1(18),10,12,14,16-pentaen-11-yl]-N-methylformamide (PubChem CID 170106611) has the molecular formula C30H37FN6O2 and a molecular weight of 532.66 g/mol. Its IUPAC name is N-[17-[6-[4-(dimethylamino)piperidin-1-yl]-3-pyridinyl]-16-fluoro-9-methyl-2-oxa-9,13-diazatetracyclo[8.7.1.03,8.014,18]octadeca-1(18),10,12,14,16-pentaen-11-yl]-N-methylformamide.
| Compound Name | N-[17-[6-[4-(dimethylamino)piperidin-1-yl]-3-pyridinyl]-16-fluoro-9-methyl-2-oxa-9,13-diazatetracyclo[8.7.1.03,8.014,18]octadeca-1(18),10,12,14,16-pentaen-11-yl]-N-methylformamide |
|---|---|
| PubChem CID | 170106611 |
| Molecular Formula | C30H37FN6O2 |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | N-[17-[6-[4-(dimethylamino)piperidin-1-yl]-3-pyridinyl]-16-fluoro-9-methyl-2-oxa-9,13-diazatetracyclo[8.7.1.03,8.014,18]octadeca-1(18),10,12,14,16-pentaen-11-yl]-N-methylformamide |
| SMILES | CN(C=O)c1cnc2cc(F)c(-c3ccc(N4CCC(N(C)C)CC4)nc3)c3c2c1N(C)C1CCCCC1O3 |
| InChI | InChI=1S/C30H37FN6O2/c1-34(2)20-11-13-37(14-12-20)26-10-9-19(16-33-26)27-21(31)15-22-28-29(24(17-32-22)35(3)18-38)36(4)23-7-5-6-8-25(23)39-30(27)28/h9-10,15-18,20,23,25H,5-8,11-14H2,1-4H3 |
| InChIKey | UIRDGNJXTCOTAC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 65.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|