C29H35FN6O3 — CID 170104960
6-[(dimethylamino)methyl]-10-fluoro-2-methyl-9-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]-7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaen-3-one (PubChem CID 170104960) has the molecular formula C29H35FN6O3 and a molecular weight of 534.64 g/mol. Its IUPAC name is 6-[(dimethylamino)methyl]-10-fluoro-2-methyl-9-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]-7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaen-3-one.
| Compound Name | 6-[(dimethylamino)methyl]-10-fluoro-2-methyl-9-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]-7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaen-3-one |
|---|---|
| PubChem CID | 170104960 |
| Molecular Formula | C29H35FN6O3 |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 6-[(dimethylamino)methyl]-10-fluoro-2-methyl-9-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]-7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaen-3-one |
| SMILES | CN(C)CC1Cn2c(=O)n(C)c3cnc4cc(F)c(-c5ccc(OCCCN6CCCCC6)nc5)c(c4c32)O1 |
| InChI | InChI=1S/C29H35FN6O3/c1-33(2)17-20-18-36-27-23(34(3)29(36)37)16-31-22-14-21(30)25(28(39-20)26(22)27)19-8-9-24(32-15-19)38-13-7-12-35-10-5-4-6-11-35/h8-9,14-16,20H,4-7,10-13,17-18H2,1-3H3 |
| InChIKey | FLSUQFOXVUYSJU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 77.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|