C29H27F2N5O3 — CID 163217827
9-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-10-fluoro-6-(4-fluorophenyl)-2-methyl-7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaen-3-one (PubChem CID 163217827) has the molecular formula C29H27F2N5O3 and a molecular weight of 531.56 g/mol. Its IUPAC name is 9-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-10-fluoro-6-(4-fluorophenyl)-2-methyl-7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaen-3-one.
| Compound Name | 9-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-10-fluoro-6-(4-fluorophenyl)-2-methyl-7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaen-3-one |
|---|---|
| PubChem CID | 163217827 |
| Molecular Formula | C29H27F2N5O3 |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 9-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-10-fluoro-6-(4-fluorophenyl)-2-methyl-7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaen-3-one |
| SMILES | CN(C)CCCOc1ccc(-c2c(F)cc3ncc4c5c3c2OC(c2ccc(F)cc2)Cn5c(=O)n4C)cn1 |
| InChI | InChI=1S/C29H27F2N5O3/c1-34(2)11-4-12-38-24-10-7-18(14-33-24)25-20(31)13-21-26-27-22(15-32-21)35(3)29(37)36(27)16-23(39-28(25)26)17-5-8-19(30)9-6-17/h5-10,13-15,23H,4,11-12,16H2,1-3H3 |
| InChIKey | QGZGBCMUWZUBEO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|