C20H14F2N4O2 — CID 170106326
10-fluoro-9-(6-fluoro-3-pyridinyl)-2-methylspiro[7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaene-5,1'-cyclopropane]-3-one (PubChem CID 170106326) has the molecular formula C20H14F2N4O2 and a molecular weight of 380.35 g/mol. Its IUPAC name is 10-fluoro-9-(6-fluoro-3-pyridinyl)-2-methylspiro[7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaene-5,1'-cyclopropane]-3-one.
| Compound Name | 10-fluoro-9-(6-fluoro-3-pyridinyl)-2-methylspiro[7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaene-5,1'-cyclopropane]-3-one |
|---|---|
| PubChem CID | 170106326 |
| Molecular Formula | C20H14F2N4O2 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 10-fluoro-9-(6-fluoro-3-pyridinyl)-2-methylspiro[7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaene-5,1'-cyclopropane]-3-one |
| SMILES | Cn1c(=O)n2c3c4c(c(-c5ccc(F)nc5)c(F)cc4ncc31)OCC21CC1 |
| InChI | InChI=1S/C20H14F2N4O2/c1-25-13-8-23-12-6-11(21)15(10-2-3-14(22)24-7-10)18-16(12)17(13)26(19(25)27)20(4-5-20)9-28-18/h2-3,6-8H,4-5,9H2,1H3 |
| InChIKey | ACNYPTLWGPESJI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|