C23H17F2N5O2 — CID 170106707
11-(2H-azirin-3-yl)-10-fluoro-9-(6-fluoro-3-pyridinyl)-2-methylspiro[7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(14),8,10,12,15-pentaene-5,1'-cyclobutane]-3-one (PubChem CID 170106707) has the molecular formula C23H17F2N5O2 and a molecular weight of 433.42 g/mol. Its IUPAC name is 11-(2H-azirin-3-yl)-10-fluoro-9-(6-fluoro-3-pyridinyl)-2-methylspiro[7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(14),8,10,12,15-pentaene-5,1'-cyclobutane]-3-one.
| Compound Name | 11-(2H-azirin-3-yl)-10-fluoro-9-(6-fluoro-3-pyridinyl)-2-methylspiro[7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(14),8,10,12,15-pentaene-5,1'-cyclobutane]-3-one |
|---|---|
| PubChem CID | 170106707 |
| Molecular Formula | C23H17F2N5O2 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 11-(2H-azirin-3-yl)-10-fluoro-9-(6-fluoro-3-pyridinyl)-2-methylspiro[7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(14),8,10,12,15-pentaene-5,1'-cyclobutane]-3-one |
| SMILES | Cn1c(=O)n2c3c4c(c(-c5ccc(F)nc5)c(F)c(C5=NC5)c4ncc31)OCC21CCC1 |
| InChI | InChI=1S/C23H17F2N5O2/c1-29-13-9-28-19-16(12-8-26-12)18(25)15(11-3-4-14(24)27-7-11)21-17(19)20(13)30(22(29)31)23(10-32-21)5-2-6-23/h3-4,7,9H,2,5-6,8,10H2,1H3 |
| InChIKey | ASSYRZRLWZEWEE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|