C29H32F3N5O2 — CID 175923175
9-[6-[3-(4,4-difluoropiperidin-1-yl)propoxy]-3-pyridinyl]-10-fluoro-2-methylspiro[7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaene-5,1'-cyclobutane] (PubChem CID 175923175) has the molecular formula C29H32F3N5O2 and a molecular weight of 539.60 g/mol. Its IUPAC name is 9-[6-[3-(4,4-difluoropiperidin-1-yl)propoxy]-3-pyridinyl]-10-fluoro-2-methylspiro[7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaene-5,1'-cyclobutane].
| Compound Name | 9-[6-[3-(4,4-difluoropiperidin-1-yl)propoxy]-3-pyridinyl]-10-fluoro-2-methylspiro[7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaene-5,1'-cyclobutane] |
|---|---|
| PubChem CID | 175923175 |
| Molecular Formula | C29H32F3N5O2 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 9-[6-[3-(4,4-difluoropiperidin-1-yl)propoxy]-3-pyridinyl]-10-fluoro-2-methylspiro[7-oxa-2,4,13-triazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaene-5,1'-cyclobutane] |
| SMILES | CN1CN2c3c1cnc1cc(F)c(-c4ccc(OCCCN5CCC(F)(F)CC5)nc4)c(c31)OCC21CCC1 |
| InChI | InChI=1S/C29H32F3N5O2/c1-35-18-37-26-22(35)16-33-21-14-20(30)24(27(25(21)26)39-17-28(37)6-2-7-28)19-4-5-23(34-15-19)38-13-3-10-36-11-8-29(31,32)9-12-36/h4-5,14-16H,2-3,6-13,17-18H2,1H3 |
| InChIKey | AHUFWEYHZAHLMV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 53.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|