C11H21NO — CID 170106719
7-propan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine (PubChem CID 170106719) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 7-propan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine.
| Compound Name | 7-propan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 170106719 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 7-propan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine |
| SMILES | CC(C)C1CCC2COCCN2C1 |
| InChI | InChI=1S/C11H21NO/c1-9(2)10-3-4-11-8-13-6-5-12(11)7-10/h9-11H,3-8H2,1-2H3 |
| InChIKey | OVVYATKZLTYIRA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |