About [4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate
[4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate (PubChem CID 170107889) has the molecular formula C14H24O8S2
and a molecular weight of 384.47 g/mol. Its IUPAC name is [4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate.
Molecular Properties
| Compound Name | [4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate |
| PubChem CID | 170107889 |
| Molecular Formula | C14H24O8S2 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate |
| SMILES | COCCCOC(=O)OCC1(COC(=O)OCCOC)CSSC1 |
| InChI | InChI=1S/C14H24O8S2/c1-17-4-3-5-19-12(15)21-8-14(10-23-24-11-14)9-22-13(16)20-7-6-18-2/h3-11H2,1-2H3 |
| InChIKey | TZWPRONIHFOMBZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate?
The IUPAC name of [4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate (CID 170107889) is [4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate.
What is the SMILES notation for [4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate?
The canonical SMILES for [4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate is COCCCOC(=O)OCC1(COC(=O)OCCOC)CSSC1.
What is the InChIKey of [4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate?
The InChIKey is TZWPRONIHFOMBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O8S2/c1-17-4-3-5-19-12(15)21-8-14(10-23-24-11-14)9-22-13(16)20-7-6-18-2/h3-11H2,1-2H3.
What are the key properties of [4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate?
[4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate has a molecular weight of 384.47 g/mol, XLogP of 2.36, 11 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-methoxyethoxycarbonyloxymethyl)dithiolan-4-yl]methyl 3-methoxypropyl carbonate is sourced from PubChem (CID 170107889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).