C21H22ClNO4S — CID 170107956
5-chloro-1'-[(4-methylsulfonylphenyl)methyl]spiro[1H-2-benzofuran-3,4'-piperidine]-1-carbaldehyde (PubChem CID 170107956) has the molecular formula C21H22ClNO4S and a molecular weight of 419.93 g/mol. Its IUPAC name is 5-chloro-1'-[(4-methylsulfonylphenyl)methyl]spiro[1H-2-benzofuran-3,4'-piperidine]-1-carbaldehyde.
| Compound Name | 5-chloro-1'-[(4-methylsulfonylphenyl)methyl]spiro[1H-2-benzofuran-3,4'-piperidine]-1-carbaldehyde |
|---|---|
| PubChem CID | 170107956 |
| Molecular Formula | C21H22ClNO4S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 5-chloro-1'-[(4-methylsulfonylphenyl)methyl]spiro[1H-2-benzofuran-3,4'-piperidine]-1-carbaldehyde |
| SMILES | CS(=O)(=O)c1ccc(CN2CCC3(CC2)OC(C=O)c2ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C21H22ClNO4S/c1-28(25,26)17-5-2-15(3-6-17)13-23-10-8-21(9-11-23)19-12-16(22)4-7-18(19)20(14-24)27-21/h2-7,12,14,20H,8-11,13H2,1H3 |
| InChIKey | YJYKRIIWZMNLJV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|