C20H21ClN2O2 — CID 170113226
5-chloro-1'-[(6-methyl-3-pyridinyl)methyl]spiro[1H-2-benzofuran-3,4'-piperidine]-1-carbaldehyde (PubChem CID 170113226) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is 5-chloro-1'-[(6-methyl-3-pyridinyl)methyl]spiro[1H-2-benzofuran-3,4'-piperidine]-1-carbaldehyde.
| Compound Name | 5-chloro-1'-[(6-methyl-3-pyridinyl)methyl]spiro[1H-2-benzofuran-3,4'-piperidine]-1-carbaldehyde |
|---|---|
| PubChem CID | 170113226 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 5-chloro-1'-[(6-methyl-3-pyridinyl)methyl]spiro[1H-2-benzofuran-3,4'-piperidine]-1-carbaldehyde |
| SMILES | Cc1ccc(CN2CCC3(CC2)OC(C=O)c2ccc(Cl)cc23)cn1 |
| InChI | InChI=1S/C20H21ClN2O2/c1-14-2-3-15(11-22-14)12-23-8-6-20(7-9-23)18-10-16(21)4-5-17(18)19(13-24)25-20/h2-5,10-11,13,19H,6-9,12H2,1H3 |
| InChIKey | BXVLFVSGCGJOAT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|