C21H25ClN2O — CID 169138217
1'-[(6-chloro-3-pyridinyl)methyl]-1,1,5-trimethylspiro[2-benzofuran-3,4'-piperidine] (PubChem CID 169138217) has the molecular formula C21H25ClN2O and a molecular weight of 356.90 g/mol. Its IUPAC name is 1'-[(6-chloro-3-pyridinyl)methyl]-1,1,5-trimethylspiro[2-benzofuran-3,4'-piperidine].
| Compound Name | 1'-[(6-chloro-3-pyridinyl)methyl]-1,1,5-trimethylspiro[2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 169138217 |
| Molecular Formula | C21H25ClN2O |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1'-[(6-chloro-3-pyridinyl)methyl]-1,1,5-trimethylspiro[2-benzofuran-3,4'-piperidine] |
| SMILES | Cc1ccc2c(c1)C1(CCN(Cc3ccc(Cl)nc3)CC1)OC2(C)C |
| InChI | InChI=1S/C21H25ClN2O/c1-15-4-6-17-18(12-15)21(25-20(17,2)3)8-10-24(11-9-21)14-16-5-7-19(22)23-13-16/h4-7,12-13H,8-11,14H2,1-3H3 |
| InChIKey | PJPGMATXXYBUTG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|