C23H24FN3O — CID 170108487
5-fluoro-2-[3-(2-methyl-2-azaspiro[3.5]nonan-7-yl)pyrrolo[2,3-c]pyridin-1-yl]benzaldehyde (PubChem CID 170108487) has the molecular formula C23H24FN3O and a molecular weight of 377.46 g/mol. Its IUPAC name is 5-fluoro-2-[3-(2-methyl-2-azaspiro[3.5]nonan-7-yl)pyrrolo[2,3-c]pyridin-1-yl]benzaldehyde.
| Compound Name | 5-fluoro-2-[3-(2-methyl-2-azaspiro[3.5]nonan-7-yl)pyrrolo[2,3-c]pyridin-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 170108487 |
| Molecular Formula | C23H24FN3O |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 5-fluoro-2-[3-(2-methyl-2-azaspiro[3.5]nonan-7-yl)pyrrolo[2,3-c]pyridin-1-yl]benzaldehyde |
| SMILES | CN1CC2(CCC(c3cn(-c4ccc(F)cc4C=O)c4cnccc34)CC2)C1 |
| InChI | InChI=1S/C23H24FN3O/c1-26-14-23(15-26)7-4-16(5-8-23)20-12-27(22-11-25-9-6-19(20)22)21-3-2-18(24)10-17(21)13-28/h2-3,6,9-13,16H,4-5,7-8,14-15H2,1H3 |
| InChIKey | GNVDSXNVDOXUKD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|