C15H20FN3O4S — CID 170110731
7-fluoro-5-[(3R)-3-methylmorpholin-4-yl]-1-methylsulfonyl-3,4-dihydro-2H-1,6-naphthyridine-8-carbaldehyde (PubChem CID 170110731) has the molecular formula C15H20FN3O4S and a molecular weight of 357.41 g/mol. Its IUPAC name is 7-fluoro-5-[(3R)-3-methylmorpholin-4-yl]-1-methylsulfonyl-3,4-dihydro-2H-1,6-naphthyridine-8-carbaldehyde.
| Compound Name | 7-fluoro-5-[(3R)-3-methylmorpholin-4-yl]-1-methylsulfonyl-3,4-dihydro-2H-1,6-naphthyridine-8-carbaldehyde |
|---|---|
| PubChem CID | 170110731 |
| Molecular Formula | C15H20FN3O4S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 7-fluoro-5-[(3R)-3-methylmorpholin-4-yl]-1-methylsulfonyl-3,4-dihydro-2H-1,6-naphthyridine-8-carbaldehyde |
| SMILES | C[C@@H]1COCCN1c1nc(F)c(C=O)c2c1CCCN2S(C)(=O)=O |
| InChI | InChI=1S/C15H20FN3O4S/c1-10-9-23-7-6-18(10)15-11-4-3-5-19(24(2,21)22)13(11)12(8-20)14(16)17-15/h8,10H,3-7,9H2,1-2H3/t10-/m1/s1 |
| InChIKey | DOEPKRNHALTZTR-SNVBAGLBSA-N |
| XLogP | 0.97 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|