C18H22N4O2 — CID 59634543
4-[4-[(3S)-3-methylmorpholin-4-yl]-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-2-yl]aniline (PubChem CID 59634543) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-[4-[(3S)-3-methylmorpholin-4-yl]-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[4-[(3S)-3-methylmorpholin-4-yl]-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 59634543 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 4-[4-[(3S)-3-methylmorpholin-4-yl]-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-2-yl]aniline |
| SMILES | C[C@H]1COCCN1c1nc(-c2ccc(N)cc2)nc2c1CCCO2 |
| InChI | InChI=1S/C18H22N4O2/c1-12-11-23-10-8-22(12)17-15-3-2-9-24-18(15)21-16(20-17)13-4-6-14(19)7-5-13/h4-7,12H,2-3,8-11,19H2,1H3/t12-/m0/s1 |
| InChIKey | ZNXNDRNCHSZXFD-LBPRGKRZSA-N |
| XLogP | 2.28 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|