C18H22N5O2- — CID 140586056
4-[4-[(3S)-3-methylmorpholin-4-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]-N-oxidoaniline (PubChem CID 140586056) has the molecular formula C18H22N5O2- and a molecular weight of 340.41 g/mol. Its IUPAC name is 4-[4-[(3S)-3-methylmorpholin-4-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]-N-oxidoaniline.
| Compound Name | 4-[4-[(3S)-3-methylmorpholin-4-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]-N-oxidoaniline |
|---|---|
| PubChem CID | 140586056 |
| Molecular Formula | C18H22N5O2- |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 4-[4-[(3S)-3-methylmorpholin-4-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]-N-oxidoaniline |
| SMILES | C[C@H]1COCCN1c1nc(-c2ccc(N[O-])cc2)nc2c1CCNC2 |
| InChI | InChI=1S/C18H22N5O2/c1-12-11-25-9-8-23(12)18-15-6-7-19-10-16(15)20-17(21-18)13-2-4-14(22-24)5-3-13/h2-5,12,19,22H,6-11H2,1H3/q-1/t12-/m0/s1 |
| InChIKey | DIKPQYGWWHTBKX-LBPRGKRZSA-N |
| XLogP | 1.92 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|