C27H34N6O2 — CID 67478290
6-butoxy-N-[4-[4-[(3S)-3-methylmorpholin-4-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]phenyl]pyridin-2-amine (PubChem CID 67478290) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 6-butoxy-N-[4-[4-[(3S)-3-methylmorpholin-4-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]phenyl]pyridin-2-amine.
| Compound Name | 6-butoxy-N-[4-[4-[(3S)-3-methylmorpholin-4-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 67478290 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 6-butoxy-N-[4-[4-[(3S)-3-methylmorpholin-4-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]phenyl]pyridin-2-amine |
| SMILES | CCCCOc1cccc(Nc2ccc(-c3nc4c(c(N5CCOC[C@@H]5C)n3)CCNC4)cc2)n1 |
| InChI | InChI=1S/C27H34N6O2/c1-3-4-15-35-25-7-5-6-24(31-25)29-21-10-8-20(9-11-21)26-30-23-17-28-13-12-22(23)27(32-26)33-14-16-34-18-19(33)2/h5-11,19,28H,3-4,12-18H2,1-2H3,(H,29,31)/t19-/m0/s1 |
| InChIKey | VPAHAZWRLHZQOY-IBGZPJMESA-N |
| XLogP | 4.33 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|