C23H27F3N6O4 — CID 87107868
[ethyl-[[4-[4-(3-methylmorpholin-4-yl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]phenyl]carbamoyl]amino] 2,2,2-trifluoroacetate (PubChem CID 87107868) has the molecular formula C23H27F3N6O4 and a molecular weight of 508.50 g/mol. Its IUPAC name is [ethyl-[[4-[4-(3-methylmorpholin-4-yl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]phenyl]carbamoyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [ethyl-[[4-[4-(3-methylmorpholin-4-yl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]phenyl]carbamoyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87107868 |
| Molecular Formula | C23H27F3N6O4 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | [ethyl-[[4-[4-(3-methylmorpholin-4-yl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]phenyl]carbamoyl]amino] 2,2,2-trifluoroacetate |
| SMILES | CCN(OC(=O)C(F)(F)F)C(=O)Nc1ccc(-c2nc3c(c(N4CCOCC4C)n2)CCNC3)cc1 |
| InChI | InChI=1S/C23H27F3N6O4/c1-3-32(36-21(33)23(24,25)26)22(34)28-16-6-4-15(5-7-16)19-29-18-12-27-9-8-17(18)20(30-19)31-10-11-35-13-14(31)2/h4-7,14,27H,3,8-13H2,1-2H3,(H,28,34) |
| InChIKey | FPOVBUPMCTXCMO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|