C17H18FN5O — CID 123950822
2-fluoro-4-[4-(3-methylmorpholin-4-yl)-5H-pyrrolo[3,4-d]pyrimidin-2-yl]aniline (PubChem CID 123950822) has the molecular formula C17H18FN5O and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-fluoro-4-[4-(3-methylmorpholin-4-yl)-5H-pyrrolo[3,4-d]pyrimidin-2-yl]aniline.
| Compound Name | 2-fluoro-4-[4-(3-methylmorpholin-4-yl)-5H-pyrrolo[3,4-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 123950822 |
| Molecular Formula | C17H18FN5O |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-fluoro-4-[4-(3-methylmorpholin-4-yl)-5H-pyrrolo[3,4-d]pyrimidin-2-yl]aniline |
| SMILES | CC1COCCN1c1nc(-c2ccc(N)c(F)c2)nc2c1CN=C2 |
| InChI | InChI=1S/C17H18FN5O/c1-10-9-24-5-4-23(10)17-12-7-20-8-15(12)21-16(22-17)11-2-3-14(19)13(18)6-11/h2-3,6,8,10H,4-5,7,9,19H2,1H3 |
| InChIKey | IYSLGBZASQGYEE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|