C20H26N6O2 — CID 118944668
2-[2-(4-aminophenyl)-7-methyl-6-[(3S)-3-methylmorpholin-4-yl]purin-8-yl]propan-2-ol (PubChem CID 118944668) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)-7-methyl-6-[(3S)-3-methylmorpholin-4-yl]purin-8-yl]propan-2-ol.
| Compound Name | 2-[2-(4-aminophenyl)-7-methyl-6-[(3S)-3-methylmorpholin-4-yl]purin-8-yl]propan-2-ol |
|---|---|
| PubChem CID | 118944668 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2-[2-(4-aminophenyl)-7-methyl-6-[(3S)-3-methylmorpholin-4-yl]purin-8-yl]propan-2-ol |
| SMILES | C[C@H]1COCCN1c1nc(-c2ccc(N)cc2)nc2nc(C(C)(C)O)n(C)c12 |
| InChI | InChI=1S/C20H26N6O2/c1-12-11-28-10-9-26(12)18-15-17(24-19(25(15)4)20(2,3)27)22-16(23-18)13-5-7-14(21)8-6-13/h5-8,12,27H,9-11,21H2,1-4H3/t12-/m0/s1 |
| InChIKey | LYGUKVVIDGDXBW-LBPRGKRZSA-N |
| XLogP | 2.07 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|