C42H32N4S — CID 170110969
6-[4-[4-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)cyclohexa-1,3-dien-1-yl]phenyl]-1,11c-dihydro-[1]benzothiolo[2,3-c]quinoline (PubChem CID 170110969) has the molecular formula C42H32N4S and a molecular weight of 624.81 g/mol. Its IUPAC name is 6-[4-[4-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)cyclohexa-1,3-dien-1-yl]phenyl]-1,11c-dihydro-[1]benzothiolo[2,3-c]quinoline.
| Compound Name | 6-[4-[4-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)cyclohexa-1,3-dien-1-yl]phenyl]-1,11c-dihydro-[1]benzothiolo[2,3-c]quinoline |
|---|---|
| PubChem CID | 170110969 |
| Molecular Formula | C42H32N4S |
| Molecular Weight | 624.81 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 6-[4-[4-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)cyclohexa-1,3-dien-1-yl]phenyl]-1,11c-dihydro-[1]benzothiolo[2,3-c]quinoline |
| SMILES | C1=CCC(c2nc(C3=CC=C(c4ccc(C5=NC6=CC=CCC6c6c5sc5ccccc65)cc4)CC3)nc(-c3ccccc3)n2)C=C1 |
| InChI | InChI=1S/C42H32N4S/c1-3-11-30(12-4-1)40-44-41(31-13-5-2-6-14-31)46-42(45-40)32-25-21-28(22-26-32)27-19-23-29(24-20-27)38-39-37(33-15-7-9-17-35(33)43-38)34-16-8-10-18-36(34)47-39/h1-13,16-21,23-25,31,33H,14-15,22,26H2 |
| InChIKey | UBIVYZKSISTNSY-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.81 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |