C26H35N7O2 — CID 170118176
N-[4-[amino(hydroxy)methyl]-1-[4-(cyanomethyl)-1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]cyclopropanecarboxamide (PubChem CID 170118176) has the molecular formula C26H35N7O2 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[4-[amino(hydroxy)methyl]-1-[4-(cyanomethyl)-1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[4-[amino(hydroxy)methyl]-1-[4-(cyanomethyl)-1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 170118176 |
| Molecular Formula | C26H35N7O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | N-[4-[amino(hydroxy)methyl]-1-[4-(cyanomethyl)-1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]cyclopropanecarboxamide |
| SMILES | N#CCC1(n2cc(C(N)O)c(NC(=O)C3CC3)n2)CCN(Cc2ccc(N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C26H35N7O2/c27-12-9-26(33-18-22(23(28)34)24(30-33)29-25(35)20-5-6-20)10-15-31(16-11-26)17-19-3-7-21(8-4-19)32-13-1-2-14-32/h3-4,7-8,18,20,23,34H,1-2,5-6,9-11,13-17,28H2,(H,29,30,35) |
| InChIKey | DPCHBOUQWYPRAR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|