C21H22FN9O2 — CID 166883091
1-[4-(cyanomethyl)-3-fluoro-1-[[4-(triazol-2-yl)phenyl]methyl]piperidin-4-yl]-3-formamidopyrazole-4-carboxamide (PubChem CID 166883091) has the molecular formula C21H22FN9O2 and a molecular weight of 451.47 g/mol. Its IUPAC name is 1-[4-(cyanomethyl)-3-fluoro-1-[[4-(triazol-2-yl)phenyl]methyl]piperidin-4-yl]-3-formamidopyrazole-4-carboxamide.
| Compound Name | 1-[4-(cyanomethyl)-3-fluoro-1-[[4-(triazol-2-yl)phenyl]methyl]piperidin-4-yl]-3-formamidopyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166883091 |
| Molecular Formula | C21H22FN9O2 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 1-[4-(cyanomethyl)-3-fluoro-1-[[4-(triazol-2-yl)phenyl]methyl]piperidin-4-yl]-3-formamidopyrazole-4-carboxamide |
| SMILES | N#CCC1(n2cc(C(N)=O)c(NC=O)n2)CCN(Cc2ccc(-n3nccn3)cc2)CC1F |
| InChI | InChI=1S/C21H22FN9O2/c22-18-13-29(11-15-1-3-16(4-2-15)31-26-8-9-27-31)10-6-21(18,5-7-23)30-12-17(19(24)33)20(28-30)25-14-32/h1-4,8-9,12,14,18H,5-6,10-11,13H2,(H2,24,33)(H,25,28,32) |
| InChIKey | KSUOGCISABJHTB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 147.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|