C20H29ClN2O2S — CID 170120146
8-(2-chloro-4-methylphenyl)sulfanyl-N-(oxan-4-yl)-1-oxa-8-azaspiro[4.5]decan-3-amine (PubChem CID 170120146) has the molecular formula C20H29ClN2O2S and a molecular weight of 396.98 g/mol. Its IUPAC name is 8-(2-chloro-4-methylphenyl)sulfanyl-N-(oxan-4-yl)-1-oxa-8-azaspiro[4.5]decan-3-amine.
| Compound Name | 8-(2-chloro-4-methylphenyl)sulfanyl-N-(oxan-4-yl)-1-oxa-8-azaspiro[4.5]decan-3-amine |
|---|---|
| PubChem CID | 170120146 |
| Molecular Formula | C20H29ClN2O2S |
| Molecular Weight | 396.98 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 8-(2-chloro-4-methylphenyl)sulfanyl-N-(oxan-4-yl)-1-oxa-8-azaspiro[4.5]decan-3-amine |
| SMILES | Cc1ccc(SN2CCC3(CC2)CC(NC2CCOCC2)CO3)c(Cl)c1 |
| InChI | InChI=1S/C20H29ClN2O2S/c1-15-2-3-19(18(21)12-15)26-23-8-6-20(7-9-23)13-17(14-25-20)22-16-4-10-24-11-5-16/h2-3,12,16-17,22H,4-11,13-14H2,1H3 |
| InChIKey | AEYQLYYLAYIWHA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.98 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|