C19H26F2N2O2S — CID 170119547
8-(2,6-difluoro-4-methylphenyl)sulfanyl-3-morpholin-4-yl-1-oxa-8-azaspiro[4.5]decane (PubChem CID 170119547) has the molecular formula C19H26F2N2O2S and a molecular weight of 384.49 g/mol. Its IUPAC name is 8-(2,6-difluoro-4-methylphenyl)sulfanyl-3-morpholin-4-yl-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(2,6-difluoro-4-methylphenyl)sulfanyl-3-morpholin-4-yl-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 170119547 |
| Molecular Formula | C19H26F2N2O2S |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 8-(2,6-difluoro-4-methylphenyl)sulfanyl-3-morpholin-4-yl-1-oxa-8-azaspiro[4.5]decane |
| SMILES | Cc1cc(F)c(SN2CCC3(CC2)CC(N2CCOCC2)CO3)c(F)c1 |
| InChI | InChI=1S/C19H26F2N2O2S/c1-14-10-16(20)18(17(21)11-14)26-23-4-2-19(3-5-23)12-15(13-25-19)22-6-8-24-9-7-22/h10-11,15H,2-9,12-13H2,1H3 |
| InChIKey | YQBQOHSPTLVYAA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|