C26H26F2N8O2 — CID 170120201
N-[4-(difluoromethoxy)-5-[[6-(1-methylindazol-5-yl)pyrimidin-4-yl]amino]-2-piperazin-1-ylphenyl]prop-2-enamide (PubChem CID 170120201) has the molecular formula C26H26F2N8O2 and a molecular weight of 520.54 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-5-[[6-(1-methylindazol-5-yl)pyrimidin-4-yl]amino]-2-piperazin-1-ylphenyl]prop-2-enamide.
| Compound Name | N-[4-(difluoromethoxy)-5-[[6-(1-methylindazol-5-yl)pyrimidin-4-yl]amino]-2-piperazin-1-ylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170120201 |
| Molecular Formula | C26H26F2N8O2 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | N-[4-(difluoromethoxy)-5-[[6-(1-methylindazol-5-yl)pyrimidin-4-yl]amino]-2-piperazin-1-ylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2cc(-c3ccc4c(cnn4C)c3)ncn2)c(OC(F)F)cc1N1CCNCC1 |
| InChI | InChI=1S/C26H26F2N8O2/c1-3-25(37)34-19-11-20(23(38-26(27)28)13-22(19)36-8-6-29-7-9-36)33-24-12-18(30-15-31-24)16-4-5-21-17(10-16)14-32-35(21)2/h3-5,10-15,26,29H,1,6-9H2,2H3,(H,34,37)(H,30,31,33) |
| InChIKey | KEKKIYZWHBPFAQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|