C29H33N8O2Si — CID 174101565
CID 174101565 (PubChem CID 174101565) has the molecular formula C29H33N8O2Si and a molecular weight of 553.72 g/mol.
| Compound Name | CID 174101565 |
|---|---|
| PubChem CID | 174101565 |
| Molecular Formula | C29H33N8O2Si |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | — |
| SMILES | C=CC(=O)Nc1cc(Nc2cc(-c3ccc4c(cnn4C)c3)ncn2)c(OC)cc1N1CCN(CC)[C@@](C)([Si])C1 |
| InChI | InChI=1S/C29H33N8O2Si/c1-6-28(38)34-22-13-23(26(39-5)15-25(22)36-10-11-37(7-2)29(3,40)17-36)33-27-14-21(30-18-31-27)19-8-9-24-20(12-19)16-32-35(24)4/h6,8-9,12-16,18H,1,7,10-11,17H2,2-5H3,(H,34,38)(H,30,31,33)/t29-/m0/s1 |
| InChIKey | SJFXWTANMPAYPK-LJAQVGFWSA-N |
| XLogP | 3.93 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|