C25H35ClN4O4 — CID 170120253
(2-chlorophenyl) (3S)-4-[(2R)-2-(cyclohexylamino)-2-piperidin-4-ylacetyl]-3-formylpiperazine-1-carboxylate (PubChem CID 170120253) has the molecular formula C25H35ClN4O4 and a molecular weight of 491.03 g/mol. Its IUPAC name is (2-chlorophenyl) (3S)-4-[(2R)-2-(cyclohexylamino)-2-piperidin-4-ylacetyl]-3-formylpiperazine-1-carboxylate.
| Compound Name | (2-chlorophenyl) (3S)-4-[(2R)-2-(cyclohexylamino)-2-piperidin-4-ylacetyl]-3-formylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 170120253 |
| Molecular Formula | C25H35ClN4O4 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | (2-chlorophenyl) (3S)-4-[(2R)-2-(cyclohexylamino)-2-piperidin-4-ylacetyl]-3-formylpiperazine-1-carboxylate |
| SMILES | O=C[C@@H]1CN(C(=O)Oc2ccccc2Cl)CCN1C(=O)[C@H](NC1CCCCC1)C1CCNCC1 |
| InChI | InChI=1S/C25H35ClN4O4/c26-21-8-4-5-9-22(21)34-25(33)29-14-15-30(20(16-29)17-31)24(32)23(18-10-12-27-13-11-18)28-19-6-2-1-3-7-19/h4-5,8-9,17-20,23,27-28H,1-3,6-7,10-16H2/t20-,23+/m0/s1 |
| InChIKey | JIISXKJBWLBJGL-NZQKXSOJSA-N |
| XLogP | 2.84 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|