C17H28N2O6P+ — CID 170122709
[(3R,5S)-1-[6-(hex-5-ynoylamino)hexanoyl]-5-(hydroxymethyl)pyrrolidin-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 170122709) has the molecular formula C17H28N2O6P+ and a molecular weight of 387.39 g/mol. Its IUPAC name is [(3R,5S)-1-[6-(hex-5-ynoylamino)hexanoyl]-5-(hydroxymethyl)pyrrolidin-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(3R,5S)-1-[6-(hex-5-ynoylamino)hexanoyl]-5-(hydroxymethyl)pyrrolidin-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 170122709 |
| Molecular Formula | C17H28N2O6P+ |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | [(3R,5S)-1-[6-(hex-5-ynoylamino)hexanoyl]-5-(hydroxymethyl)pyrrolidin-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | C#CCCCC(=O)NCCCCCC(=O)N1C[C@H](O[P+](=O)O)C[C@H]1CO |
| InChI | InChI=1S/C17H27N2O6P/c1-2-3-5-8-16(21)18-10-7-4-6-9-17(22)19-12-15(25-26(23)24)11-14(19)13-20/h1,14-15,20H,3-13H2,(H-,18,21,23,24)/p+1/t14-,15+/m0/s1 |
| InChIKey | KMBHPTOQSPFHSV-LSDHHAIUSA-O |
| XLogP | 1.09 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|