C12H23N3O4 — CID 121419437
[6-[(2R,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohexyl]urea (PubChem CID 121419437) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is [6-[(2R,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohexyl]urea.
| Compound Name | [6-[(2R,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohexyl]urea |
|---|---|
| PubChem CID | 121419437 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [6-[(2R,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohexyl]urea |
| SMILES | NC(=O)NCCCCCC(=O)N1C[C@@H](O)C[C@@H]1CO |
| InChI | InChI=1S/C12H23N3O4/c13-12(19)14-5-3-1-2-4-11(18)15-7-10(17)6-9(15)8-16/h9-10,16-17H,1-8H2,(H3,13,14,19)/t9-,10+/m1/s1 |
| InChIKey | UDCHEFXDAZVGAN-ZJUUUORDSA-N |
| XLogP | -0.83 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|