C16H29NO5 — CID 176754655
methyl 10-[(2S,4R)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]-10-oxodecanoate (PubChem CID 176754655) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is methyl 10-[(2S,4R)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]-10-oxodecanoate.
| Compound Name | methyl 10-[(2S,4R)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]-10-oxodecanoate |
|---|---|
| PubChem CID | 176754655 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | methyl 10-[(2S,4R)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]-10-oxodecanoate |
| SMILES | COC(=O)CCCCCCCCC(=O)N1C[C@H](O)C[C@H]1CO |
| InChI | InChI=1S/C16H29NO5/c1-22-16(21)9-7-5-3-2-4-6-8-15(20)17-11-14(19)10-13(17)12-18/h13-14,18-19H,2-12H2,1H3/t13-,14+/m0/s1 |
| InChIKey | NIOMPAMNHTWSBK-UONOGXRCSA-N |
| XLogP | 1.23 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|