C16H27N3O2 — CID 95164398
[5-[(1S,8R)-4-azatricyclo[4.3.1.13,8]undecan-4-yl]-5-oxopentyl]urea (PubChem CID 95164398) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is [5-[(1S,8R)-4-azatricyclo[4.3.1.13,8]undecan-4-yl]-5-oxopentyl]urea.
| Compound Name | [5-[(1S,8R)-4-azatricyclo[4.3.1.13,8]undecan-4-yl]-5-oxopentyl]urea |
|---|---|
| PubChem CID | 95164398 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | [5-[(1S,8R)-4-azatricyclo[4.3.1.13,8]undecan-4-yl]-5-oxopentyl]urea |
| SMILES | NC(=O)NCCCCC(=O)N1CC2C[C@@H]3CC1C[C@H](C2)C3 |
| InChI | InChI=1S/C16H27N3O2/c17-16(21)18-4-2-1-3-15(20)19-10-13-6-11-5-12(7-13)9-14(19)8-11/h11-14H,1-10H2,(H3,17,18,21)/t11-,12+,13?,14? |
| InChIKey | NBXLDJUHGPHDQD-VTXSZYRJSA-N |
| XLogP | 1.86 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|